C14H21N3O3S — CID 79671023
3-[3-[(2-methoxyethylamino)methyl]imidazo[1,2-a]pyridin-2-yl]sulfanylpropane-1,2-diol (PubChem CID 79671023) has the molecular formula C14H21N3O3S and a molecular weight of 311.41 g/mol. Its IUPAC name is 3-[3-[(2-methoxyethylamino)methyl]imidazo[1,2-a]pyridin-2-yl]sulfanylpropane-1,2-diol.
| Compound Name | 3-[3-[(2-methoxyethylamino)methyl]imidazo[1,2-a]pyridin-2-yl]sulfanylpropane-1,2-diol |
|---|---|
| PubChem CID | 79671023 |
| Molecular Formula | C14H21N3O3S |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 3-[3-[(2-methoxyethylamino)methyl]imidazo[1,2-a]pyridin-2-yl]sulfanylpropane-1,2-diol |
| SMILES | COCCNCc1c(SCC(O)CO)nc2ccccn12 |
| InChI | InChI=1S/C14H21N3O3S/c1-20-7-5-15-8-12-14(21-10-11(19)9-18)16-13-4-2-3-6-17(12)13/h2-4,6,11,15,18-19H,5,7-10H2,1H3 |
| InChIKey | YKRWPLLZPUDKDL-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 79.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|