C14H19NO3 — CID 63060100
2-methoxy-N-[(4-methoxy-2-prop-2-ynoxyphenyl)methyl]ethanamine (PubChem CID 63060100) has the molecular formula C14H19NO3 and a molecular weight of 249.31 g/mol. Its IUPAC name is 2-methoxy-N-[(4-methoxy-2-prop-2-ynoxyphenyl)methyl]ethanamine.
| Compound Name | 2-methoxy-N-[(4-methoxy-2-prop-2-ynoxyphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 63060100 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | 2-methoxy-N-[(4-methoxy-2-prop-2-ynoxyphenyl)methyl]ethanamine |
| SMILES | C#CCOc1cc(OC)ccc1CNCCOC |
| InChI | InChI=1S/C14H19NO3/c1-4-8-18-14-10-13(17-3)6-5-12(14)11-15-7-9-16-2/h1,5-6,10,15H,7-9,11H2,2-3H3 |
| InChIKey | BJWZVPHMXVJJPM-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|