C13H21N3O3S — CID 63068067
2-ethoxy-4-[4-(1,3-thiazol-2-yl)piperazin-1-yl]butanoic acid (PubChem CID 63068067) has the molecular formula C13H21N3O3S and a molecular weight of 299.40 g/mol. Its IUPAC name is 2-ethoxy-4-[4-(1,3-thiazol-2-yl)piperazin-1-yl]butanoic acid.
| Compound Name | 2-ethoxy-4-[4-(1,3-thiazol-2-yl)piperazin-1-yl]butanoic acid |
|---|---|
| PubChem CID | 63068067 |
| Molecular Formula | C13H21N3O3S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 2-ethoxy-4-[4-(1,3-thiazol-2-yl)piperazin-1-yl]butanoic acid |
| SMILES | CCOC(CCN1CCN(c2nccs2)CC1)C(=O)O |
| InChI | InChI=1S/C13H21N3O3S/c1-2-19-11(12(17)18)3-5-15-6-8-16(9-7-15)13-14-4-10-20-13/h4,10-11H,2-3,5-9H2,1H3,(H,17,18) |
| InChIKey | YRIFQLXNANJXJC-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 65.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |