C12H14F3NO2 — CID 63077158
2-(butan-2-ylamino)-2-(3,4,5-trifluorophenyl)acetic acid (PubChem CID 63077158) has the molecular formula C12H14F3NO2 and a molecular weight of 261.24 g/mol. Its IUPAC name is 2-(butan-2-ylamino)-2-(3,4,5-trifluorophenyl)acetic acid.
| Compound Name | 2-(butan-2-ylamino)-2-(3,4,5-trifluorophenyl)acetic acid |
|---|---|
| PubChem CID | 63077158 |
| Molecular Formula | C12H14F3NO2 |
| Molecular Weight | 261.24 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 2-(butan-2-ylamino)-2-(3,4,5-trifluorophenyl)acetic acid |
| SMILES | CCC(C)NC(C(=O)O)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C12H14F3NO2/c1-3-6(2)16-11(12(17)18)7-4-8(13)10(15)9(14)5-7/h4-6,11,16H,3H2,1-2H3,(H,17,18) |
| InChIKey | YFSCYISWVFOMRU-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.24 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|