C22H33N3O — CID 630943
1-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)-2-(3,3,9-trimethyl-7,8-diazatricyclo[4.3.0.02,4]nona-1(6),8-dien-7-yl)ethanone (PubChem CID 630943) has the molecular formula C22H33N3O and a molecular weight of 355.53 g/mol. Its IUPAC name is 1-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)-2-(3,3,9-trimethyl-7,8-diazatricyclo[4.3.0.02,4]nona-1(6),8-dien-7-yl)ethanone.
| Compound Name | 1-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)-2-(3,3,9-trimethyl-7,8-diazatricyclo[4.3.0.02,4]nona-1(6),8-dien-7-yl)ethanone |
|---|---|
| PubChem CID | 630943 |
| Molecular Formula | C22H33N3O |
| Molecular Weight | 355.53 g/mol |
| Exact Mass | 355.26 |
| IUPAC Name | 1-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)-2-(3,3,9-trimethyl-7,8-diazatricyclo[4.3.0.02,4]nona-1(6),8-dien-7-yl)ethanone |
| SMILES | Cc1nn(CC(=O)N2CC3(C)CC2CC(C)(C)C3)c2c1C1C(C2)C1(C)C |
| InChI | InChI=1S/C22H33N3O/c1-13-18-16(7-15-19(18)21(15,4)5)25(23-13)10-17(26)24-12-22(6)9-14(24)8-20(2,3)11-22/h14-15,19H,7-12H2,1-6H3 |
| InChIKey | NQHRPUQJUPOLDQ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.53 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |