C17H26N4O3 — CID 8851106
2-(3,5-dimethyl-4-nitropyrazol-1-yl)-1-[(1R,5R)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]ethanone (PubChem CID 8851106) has the molecular formula C17H26N4O3 and a molecular weight of 334.42 g/mol. Its IUPAC name is 2-(3,5-dimethyl-4-nitropyrazol-1-yl)-1-[(1R,5R)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]ethanone.
| Compound Name | 2-(3,5-dimethyl-4-nitropyrazol-1-yl)-1-[(1R,5R)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]ethanone |
|---|---|
| PubChem CID | 8851106 |
| Molecular Formula | C17H26N4O3 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | 2-(3,5-dimethyl-4-nitropyrazol-1-yl)-1-[(1R,5R)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]ethanone |
| SMILES | Cc1nn(CC(=O)N2C[C@@]3(C)C[C@H]2CC(C)(C)C3)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C17H26N4O3/c1-11-15(21(23)24)12(2)20(18-11)8-14(22)19-10-17(5)7-13(19)6-16(3,4)9-17/h13H,6-10H2,1-5H3/t13-,17+/m1/s1 |
| InChIKey | GYHBWKHCABAUKZ-DYVFJYSZSA-N |
| XLogP | 2.84 |
| TPSA | 81.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|