C24H27ClN2O4 — CID 6309597
(E)-3-[4-[2-(4-butan-2-ylphenoxy)ethoxy]-3-chloro-5-ethoxyphenyl]-2-cyanoprop-2-enamide (PubChem CID 6309597) has the molecular formula C24H27ClN2O4 and a molecular weight of 442.94 g/mol. Its IUPAC name is (E)-3-[4-[2-(4-butan-2-ylphenoxy)ethoxy]-3-chloro-5-ethoxyphenyl]-2-cyanoprop-2-enamide.
| Compound Name | (E)-3-[4-[2-(4-butan-2-ylphenoxy)ethoxy]-3-chloro-5-ethoxyphenyl]-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 6309597 |
| Molecular Formula | C24H27ClN2O4 |
| Molecular Weight | 442.94 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | (E)-3-[4-[2-(4-butan-2-ylphenoxy)ethoxy]-3-chloro-5-ethoxyphenyl]-2-cyanoprop-2-enamide |
| SMILES | CCOc1cc(/C=C(\C#N)C(N)=O)cc(Cl)c1OCCOc1ccc(C(C)CC)cc1 |
| InChI | InChI=1S/C24H27ClN2O4/c1-4-16(3)18-6-8-20(9-7-18)30-10-11-31-23-21(25)13-17(14-22(23)29-5-2)12-19(15-26)24(27)28/h6-9,12-14,16H,4-5,10-11H2,1-3H3,(H2,27,28)/b19-12+ |
| InChIKey | DNIOUJWCXWOGSG-XDHOZWIPSA-N |
| XLogP | 5.10 |
| TPSA | 94.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.94 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|