C9H15NO2 — CID 63106217
(Z)-1-(3-hydroxyazetidin-1-yl)-2-methylpent-2-en-1-one (PubChem CID 63106217) has the molecular formula C9H15NO2 and a molecular weight of 169.22 g/mol. Its IUPAC name is (Z)-1-(3-hydroxyazetidin-1-yl)-2-methylpent-2-en-1-one.
| Compound Name | (Z)-1-(3-hydroxyazetidin-1-yl)-2-methylpent-2-en-1-one |
|---|---|
| PubChem CID | 63106217 |
| Molecular Formula | C9H15NO2 |
| Molecular Weight | 169.22 g/mol |
| Exact Mass | 169.11 |
| IUPAC Name | (Z)-1-(3-hydroxyazetidin-1-yl)-2-methylpent-2-en-1-one |
| SMILES | CC/C=C(/C)C(=O)N1CC(O)C1 |
| InChI | InChI=1S/C9H15NO2/c1-3-4-7(2)9(12)10-5-8(11)6-10/h4,8,11H,3,5-6H2,1-2H3/b7-4- |
| InChIKey | DHNQWZIDFOMWOO-DAXSKMNVSA-N |
| XLogP | 0.55 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.22 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|