C9H6BrNO4 — CID 63109398
5-bromo-8-methoxy-1H-3,1-benzoxazine-2,4-dione (PubChem CID 63109398) has the molecular formula C9H6BrNO4 and a molecular weight of 272.05 g/mol. Its IUPAC name is 5-bromo-8-methoxy-1H-3,1-benzoxazine-2,4-dione.
| Compound Name | 5-bromo-8-methoxy-1H-3,1-benzoxazine-2,4-dione |
|---|---|
| PubChem CID | 63109398 |
| Molecular Formula | C9H6BrNO4 |
| Molecular Weight | 272.05 g/mol |
| Exact Mass | 270.95 |
| IUPAC Name | 5-bromo-8-methoxy-1H-3,1-benzoxazine-2,4-dione |
| SMILES | COc1ccc(Br)c2c(=O)oc(=O)[nH]c12 |
| InChI | InChI=1S/C9H6BrNO4/c1-14-5-3-2-4(10)6-7(5)11-9(13)15-8(6)12/h2-3H,1H3,(H,11,13) |
| InChIKey | OMIWYFVXSRBWTH-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 72.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.05 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |