C14H16F3N3O — CID 63117962
7-amino-N-propan-2-yl-N-(2,2,2-trifluoroethyl)-1H-indole-2-carboxamide (PubChem CID 63117962) has the molecular formula C14H16F3N3O and a molecular weight of 299.30 g/mol. Its IUPAC name is 7-amino-N-propan-2-yl-N-(2,2,2-trifluoroethyl)-1H-indole-2-carboxamide.
| Compound Name | 7-amino-N-propan-2-yl-N-(2,2,2-trifluoroethyl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 63117962 |
| Molecular Formula | C14H16F3N3O |
| Molecular Weight | 299.30 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 7-amino-N-propan-2-yl-N-(2,2,2-trifluoroethyl)-1H-indole-2-carboxamide |
| SMILES | CC(C)N(CC(F)(F)F)C(=O)c1cc2cccc(N)c2[nH]1 |
| InChI | InChI=1S/C14H16F3N3O/c1-8(2)20(7-14(15,16)17)13(21)11-6-9-4-3-5-10(18)12(9)19-11/h3-6,8,19H,7,18H2,1-2H3 |
| InChIKey | IZXGXJQWWZFUDL-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.30 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|