About N-[(4-ethylpiperidin-4-yl)methyl]-N,2-dimethylbutan-1-amine
N-[(4-ethylpiperidin-4-yl)methyl]-N,2-dimethylbutan-1-amine (PubChem CID 63129369) has the molecular formula C14H30N2
and a molecular weight of 226.41 g/mol. Its IUPAC name is N-[(4-ethylpiperidin-4-yl)methyl]-N,2-dimethylbutan-1-amine.
Molecular Properties
| Compound Name | N-[(4-ethylpiperidin-4-yl)methyl]-N,2-dimethylbutan-1-amine |
| PubChem CID | 63129369 |
| Molecular Formula | C14H30N2 |
| Molecular Weight | 226.41 g/mol |
| Exact Mass | 226.24 |
| IUPAC Name | N-[(4-ethylpiperidin-4-yl)methyl]-N,2-dimethylbutan-1-amine |
| SMILES | CCC(C)CN(C)CC1(CC)CCNCC1 |
| InChI | InChI=1S/C14H30N2/c1-5-13(3)11-16(4)12-14(6-2)7-9-15-10-8-14/h13,15H,5-12H2,1-4H3 |
| InChIKey | UYGJDKVKRACJKQ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.41 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(4-ethylpiperidin-4-yl)methyl]-N,2-dimethylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4-ethylpiperidin-4-yl)methyl]-N,2-dimethylbutan-1-amine?
The IUPAC name of N-[(4-ethylpiperidin-4-yl)methyl]-N,2-dimethylbutan-1-amine (CID 63129369) is N-[(4-ethylpiperidin-4-yl)methyl]-N,2-dimethylbutan-1-amine.
What is the SMILES notation for N-[(4-ethylpiperidin-4-yl)methyl]-N,2-dimethylbutan-1-amine?
The canonical SMILES for N-[(4-ethylpiperidin-4-yl)methyl]-N,2-dimethylbutan-1-amine is CCC(C)CN(C)CC1(CC)CCNCC1.
What is the InChIKey of N-[(4-ethylpiperidin-4-yl)methyl]-N,2-dimethylbutan-1-amine?
The InChIKey is UYGJDKVKRACJKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H30N2/c1-5-13(3)11-16(4)12-14(6-2)7-9-15-10-8-14/h13,15H,5-12H2,1-4H3.
What are the key properties of N-[(4-ethylpiperidin-4-yl)methyl]-N,2-dimethylbutan-1-amine?
N-[(4-ethylpiperidin-4-yl)methyl]-N,2-dimethylbutan-1-amine has a molecular weight of 226.41 g/mol, XLogP of 2.74, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4-ethylpiperidin-4-yl)methyl]-N,2-dimethylbutan-1-amine is sourced from PubChem (CID 63129369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).