C32H33N5O4S2 — CID 6315496
5-[(Z)-[3-[2-(3,4-dimethoxyphenyl)ethyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-1,4-dimethyl-2-oxo-6-(4-phenylpiperazin-1-yl)pyridine-3-carbonitrile (PubChem CID 6315496) has the molecular formula C32H33N5O4S2 and a molecular weight of 615.78 g/mol. Its IUPAC name is 5-[(Z)-[3-[2-(3,4-dimethoxyphenyl)ethyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-1,4-dimethyl-2-oxo-6-(4-phenylpiperazin-1-yl)pyridine-3-carbonitrile.
| Compound Name | 5-[(Z)-[3-[2-(3,4-dimethoxyphenyl)ethyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-1,4-dimethyl-2-oxo-6-(4-phenylpiperazin-1-yl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 6315496 |
| Molecular Formula | C32H33N5O4S2 |
| Molecular Weight | 615.78 g/mol |
| Exact Mass | 615.20 |
| IUPAC Name | 5-[(Z)-[3-[2-(3,4-dimethoxyphenyl)ethyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-1,4-dimethyl-2-oxo-6-(4-phenylpiperazin-1-yl)pyridine-3-carbonitrile |
| SMILES | COc1ccc(CCN2C(=O)/C(=C/c3c(C)c(C#N)c(=O)n(C)c3N3CCN(c4ccccc4)CC3)SC2=S)cc1OC |
| InChI | InChI=1S/C32H33N5O4S2/c1-21-24(19-28-31(39)37(32(42)43-28)13-12-22-10-11-26(40-3)27(18-22)41-4)29(34(2)30(38)25(21)20-33)36-16-14-35(15-17-36)23-8-6-5-7-9-23/h5-11,18-19H,12-17H2,1-4H3/b28-19- |
| InChIKey | OPHUBYSCLAEDQR-USHMODERSA-N |
| XLogP | 4.35 |
| TPSA | 91.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.78 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|