C18H28FNO — CID 63160173
3-(4,4-diethylpiperidin-1-yl)-1-(2-fluorophenyl)propan-1-ol (PubChem CID 63160173) has the molecular formula C18H28FNO and a molecular weight of 293.43 g/mol. Its IUPAC name is 3-(4,4-diethylpiperidin-1-yl)-1-(2-fluorophenyl)propan-1-ol.
| Compound Name | 3-(4,4-diethylpiperidin-1-yl)-1-(2-fluorophenyl)propan-1-ol |
|---|---|
| PubChem CID | 63160173 |
| Molecular Formula | C18H28FNO |
| Molecular Weight | 293.43 g/mol |
| Exact Mass | 293.22 |
| IUPAC Name | 3-(4,4-diethylpiperidin-1-yl)-1-(2-fluorophenyl)propan-1-ol |
| SMILES | CCC1(CC)CCN(CCC(O)c2ccccc2F)CC1 |
| InChI | InChI=1S/C18H28FNO/c1-3-18(4-2)10-13-20(14-11-18)12-9-17(21)15-7-5-6-8-16(15)19/h5-8,17,21H,3-4,9-14H2,1-2H3 |
| InChIKey | KPBDYBCMGCIDRA-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.43 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |