C16H29N5 — CID 63163164
N-[[1-[2-(8-azaspiro[4.5]decan-8-yl)ethyl]triazol-4-yl]methyl]ethanamine (PubChem CID 63163164) has the molecular formula C16H29N5 and a molecular weight of 291.44 g/mol. Its IUPAC name is N-[[1-[2-(8-azaspiro[4.5]decan-8-yl)ethyl]triazol-4-yl]methyl]ethanamine.
| Compound Name | N-[[1-[2-(8-azaspiro[4.5]decan-8-yl)ethyl]triazol-4-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 63163164 |
| Molecular Formula | C16H29N5 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.24 |
| IUPAC Name | N-[[1-[2-(8-azaspiro[4.5]decan-8-yl)ethyl]triazol-4-yl]methyl]ethanamine |
| SMILES | CCNCc1cn(CCN2CCC3(CCCC3)CC2)nn1 |
| InChI | InChI=1S/C16H29N5/c1-2-17-13-15-14-21(19-18-15)12-11-20-9-7-16(8-10-20)5-3-4-6-16/h14,17H,2-13H2,1H3 |
| InChIKey | LCMYBSYVSDUEIG-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |