C9H16O5S — CID 63166307
2-(3-hydroxy-1,1-dioxothiolan-3-yl)-3-methylbutanoic acid (PubChem CID 63166307) has the molecular formula C9H16O5S and a molecular weight of 236.29 g/mol. Its IUPAC name is 2-(3-hydroxy-1,1-dioxothiolan-3-yl)-3-methylbutanoic acid.
| Compound Name | 2-(3-hydroxy-1,1-dioxothiolan-3-yl)-3-methylbutanoic acid |
|---|---|
| PubChem CID | 63166307 |
| Molecular Formula | C9H16O5S |
| Molecular Weight | 236.29 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | 2-(3-hydroxy-1,1-dioxothiolan-3-yl)-3-methylbutanoic acid |
| SMILES | CC(C)C(C(=O)O)C1(O)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H16O5S/c1-6(2)7(8(10)11)9(12)3-4-15(13,14)5-9/h6-7,12H,3-5H2,1-2H3,(H,10,11) |
| InChIKey | UVDSKYGVEUKISY-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.29 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |