About 2-[(3S,4R)-4-(carboxymethyl)-1,1-dioxothiolan-3-yl]acetic acid
2-[(3S,4R)-4-(carboxymethyl)-1,1-dioxothiolan-3-yl]acetic acid (PubChem CID 1398080) has the molecular formula C8H12O6S
and a molecular weight of 236.24 g/mol. Its IUPAC name is 2-[(3S,4R)-4-(carboxymethyl)-1,1-dioxothiolan-3-yl]acetic acid.
Analyze 2-[(3S,4R)-4-(carboxymethyl)-1,1-dioxothiolan-3-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3S,4R)-4-(carboxymethyl)-1,1-dioxothiolan-3-yl]acetic acid?
The IUPAC name of 2-[(3S,4R)-4-(carboxymethyl)-1,1-dioxothiolan-3-yl]acetic acid (CID 1398080) is 2-[(3S,4R)-4-(carboxymethyl)-1,1-dioxothiolan-3-yl]acetic acid.
What is the SMILES notation for 2-[(3S,4R)-4-(carboxymethyl)-1,1-dioxothiolan-3-yl]acetic acid?
The canonical SMILES for 2-[(3S,4R)-4-(carboxymethyl)-1,1-dioxothiolan-3-yl]acetic acid is O=C(O)C[C@@H]1CS(=O)(=O)C[C@@H]1CC(=O)O.
What is the InChIKey of 2-[(3S,4R)-4-(carboxymethyl)-1,1-dioxothiolan-3-yl]acetic acid?
The InChIKey is CRCJOBAWARYSAS-OLQVQODUSA-N. The full InChI is InChI=1S/C8H12O6S/c9-7(10)1-5-3-15(13,14)4-6(5)2-8(11)12/h5-6H,1-4H2,(H,9,10)(H,11,12)/t5-,6+.
What are the key properties of 2-[(3S,4R)-4-(carboxymethyl)-1,1-dioxothiolan-3-yl]acetic acid?
2-[(3S,4R)-4-(carboxymethyl)-1,1-dioxothiolan-3-yl]acetic acid has a molecular weight of 236.24 g/mol, XLogP of -0.40, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3S,4R)-4-(carboxymethyl)-1,1-dioxothiolan-3-yl]acetic acid is sourced from PubChem (CID 1398080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).