C10H18N2O2S — CID 63172717
3-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)thiolane 1,1-dioxide (PubChem CID 63172717) has the molecular formula C10H18N2O2S and a molecular weight of 230.33 g/mol. Its IUPAC name is 3-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)thiolane 1,1-dioxide.
| Compound Name | 3-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 63172717 |
| Molecular Formula | C10H18N2O2S |
| Molecular Weight | 230.33 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 3-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)thiolane 1,1-dioxide |
| SMILES | O=S1(=O)CCC(N2CC3CNCC3C2)C1 |
| InChI | InChI=1S/C10H18N2O2S/c13-15(14)2-1-10(7-15)12-5-8-3-11-4-9(8)6-12/h8-11H,1-7H2 |
| InChIKey | FJDUXJAQXYPHNR-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.33 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |