C13H20N2S — CID 63177482
N-cyclopropyl-2,2-dimethyl-N-(thiophen-2-ylmethyl)propanimidamide (PubChem CID 63177482) has the molecular formula C13H20N2S and a molecular weight of 236.38 g/mol. Its IUPAC name is N-cyclopropyl-2,2-dimethyl-N-(thiophen-2-ylmethyl)propanimidamide.
| Compound Name | N-cyclopropyl-2,2-dimethyl-N-(thiophen-2-ylmethyl)propanimidamide |
|---|---|
| PubChem CID | 63177482 |
| Molecular Formula | C13H20N2S |
| Molecular Weight | 236.38 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | N-cyclopropyl-2,2-dimethyl-N-(thiophen-2-ylmethyl)propanimidamide |
| SMILES | [H]/N=C(/N(Cc1cccs1)C1CC1)C(C)(C)C |
| InChI | InChI=1S/C13H20N2S/c1-13(2,3)12(14)15(10-6-7-10)9-11-5-4-8-16-11/h4-5,8,10,14H,6-7,9H2,1-3H3/b14-12+ |
| InChIKey | HPMILVYAXOEPMC-WYMLVPIESA-N |
| XLogP | 3.74 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.38 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|