C13H17FN2 — CID 63181376
N'-[1-(4-fluorophenyl)propan-2-yl]cyclopropanecarboximidamide (PubChem CID 63181376) has the molecular formula C13H17FN2 and a molecular weight of 220.29 g/mol. Its IUPAC name is N'-[1-(4-fluorophenyl)propan-2-yl]cyclopropanecarboximidamide.
| Compound Name | N'-[1-(4-fluorophenyl)propan-2-yl]cyclopropanecarboximidamide |
|---|---|
| PubChem CID | 63181376 |
| Molecular Formula | C13H17FN2 |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 220.14 |
| IUPAC Name | N'-[1-(4-fluorophenyl)propan-2-yl]cyclopropanecarboximidamide |
| SMILES | CC(Cc1ccc(F)cc1)/N=C(\N)C1CC1 |
| InChI | InChI=1S/C13H17FN2/c1-9(16-13(15)11-4-5-11)8-10-2-6-12(14)7-3-10/h2-3,6-7,9,11H,4-5,8H2,1H3,(H2,15,16) |
| InChIKey | LYANDFJACDPZKG-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|