C12H16N2O — CID 63181471
N'-cyclopropyl-2-(3-methoxyphenyl)ethanimidamide (PubChem CID 63181471) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is N'-cyclopropyl-2-(3-methoxyphenyl)ethanimidamide.
| Compound Name | N'-cyclopropyl-2-(3-methoxyphenyl)ethanimidamide |
|---|---|
| PubChem CID | 63181471 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | N'-cyclopropyl-2-(3-methoxyphenyl)ethanimidamide |
| SMILES | COc1cccc(C/C(N)=N/C2CC2)c1 |
| InChI | InChI=1S/C12H16N2O/c1-15-11-4-2-3-9(7-11)8-12(13)14-10-5-6-10/h2-4,7,10H,5-6,8H2,1H3,(H2,13,14) |
| InChIKey | OOANVZCCDJUKRO-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|