C13H17F2N3O2 — CID 63187540
3,5-difluoro-4-(2-piperazin-1-ylethylamino)benzoic acid (PubChem CID 63187540) has the molecular formula C13H17F2N3O2 and a molecular weight of 285.29 g/mol. Its IUPAC name is 3,5-difluoro-4-(2-piperazin-1-ylethylamino)benzoic acid.
| Compound Name | 3,5-difluoro-4-(2-piperazin-1-ylethylamino)benzoic acid |
|---|---|
| PubChem CID | 63187540 |
| Molecular Formula | C13H17F2N3O2 |
| Molecular Weight | 285.29 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 3,5-difluoro-4-(2-piperazin-1-ylethylamino)benzoic acid |
| SMILES | O=C(O)c1cc(F)c(NCCN2CCNCC2)c(F)c1 |
| InChI | InChI=1S/C13H17F2N3O2/c14-10-7-9(13(19)20)8-11(15)12(10)17-3-6-18-4-1-16-2-5-18/h7-8,16-17H,1-6H2,(H,19,20) |
| InChIKey | GYBLCLVRCFXIJN-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.29 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |