About N-(2-cyanopropan-2-yl)-N-cyclopropyl-3,4,5-trifluorobenzamide
N-(2-cyanopropan-2-yl)-N-cyclopropyl-3,4,5-trifluorobenzamide (PubChem CID 63189173) has the molecular formula C14H13F3N2O
and a molecular weight of 282.27 g/mol. Its IUPAC name is N-(2-cyanopropan-2-yl)-N-cyclopropyl-3,4,5-trifluorobenzamide.
Molecular Properties
| Compound Name | N-(2-cyanopropan-2-yl)-N-cyclopropyl-3,4,5-trifluorobenzamide |
| PubChem CID | 63189173 |
| Molecular Formula | C14H13F3N2O |
| Molecular Weight | 282.27 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | N-(2-cyanopropan-2-yl)-N-cyclopropyl-3,4,5-trifluorobenzamide |
| SMILES | CC(C)(C#N)N(C(=O)c1cc(F)c(F)c(F)c1)C1CC1 |
| InChI | InChI=1S/C14H13F3N2O/c1-14(2,7-18)19(9-3-4-9)13(20)8-5-10(15)12(17)11(16)6-8/h5-6,9H,3-4H2,1-2H3 |
| InChIKey | GVOJSVVFWJDHDW-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.27 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze N-(2-cyanopropan-2-yl)-N-cyclopropyl-3,4,5-trifluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-cyanopropan-2-yl)-N-cyclopropyl-3,4,5-trifluorobenzamide?
The IUPAC name of N-(2-cyanopropan-2-yl)-N-cyclopropyl-3,4,5-trifluorobenzamide (CID 63189173) is N-(2-cyanopropan-2-yl)-N-cyclopropyl-3,4,5-trifluorobenzamide.
What is the SMILES notation for N-(2-cyanopropan-2-yl)-N-cyclopropyl-3,4,5-trifluorobenzamide?
The canonical SMILES for N-(2-cyanopropan-2-yl)-N-cyclopropyl-3,4,5-trifluorobenzamide is CC(C)(C#N)N(C(=O)c1cc(F)c(F)c(F)c1)C1CC1.
What is the InChIKey of N-(2-cyanopropan-2-yl)-N-cyclopropyl-3,4,5-trifluorobenzamide?
The InChIKey is GVOJSVVFWJDHDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13F3N2O/c1-14(2,7-18)19(9-3-4-9)13(20)8-5-10(15)12(17)11(16)6-8/h5-6,9H,3-4H2,1-2H3.
What are the key properties of N-(2-cyanopropan-2-yl)-N-cyclopropyl-3,4,5-trifluorobenzamide?
N-(2-cyanopropan-2-yl)-N-cyclopropyl-3,4,5-trifluorobenzamide has a molecular weight of 282.27 g/mol, XLogP of 3.01, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-cyanopropan-2-yl)-N-cyclopropyl-3,4,5-trifluorobenzamide is sourced from PubChem (CID 63189173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).