4-[(2,5-dimethylbenzoyl)amino]-3-fluorobenzoic acid

C16H14FNO3 — CID 63189869

IUPAC4-[(2,5-dimethylbenzoyl)amino]-3-fluorobenzoic acid
SMILESCc1ccc(C)c(C(=O)Nc2ccc(C(=O)O)cc2F)c1
InChIInChI=1S/C16H14FNO3/c1-9-3-4-10(2)12(7-9)15(19)18-14-6-5-11(16(20)21)8-13(14)17/h3-8H,1-2H3,(H,18,19)(H,20,21)
InChIKeyVVYZXXANBSEQAP-UHFFFAOYSA-N
MW287.29 g/mol
LogP3.39
Rot. Bonds3

About 4-[(2,5-dimethylbenzoyl)amino]-3-fluorobenzoic acid

4-[(2,5-dimethylbenzoyl)amino]-3-fluorobenzoic acid (PubChem CID 63189869) has the molecular formula C16H14FNO3 and a molecular weight of 287.29 g/mol. Its IUPAC name is 4-[(2,5-dimethylbenzoyl)amino]-3-fluorobenzoic acid.

Molecular Properties

Compound Name4-[(2,5-dimethylbenzoyl)amino]-3-fluorobenzoic acid
PubChem CID63189869
Molecular FormulaC16H14FNO3
Molecular Weight287.29 g/mol
Exact Mass287.10
IUPAC Name4-[(2,5-dimethylbenzoyl)amino]-3-fluorobenzoic acid
SMILESCc1ccc(C)c(C(=O)Nc2ccc(C(=O)O)cc2F)c1
InChIInChI=1S/C16H14FNO3/c1-9-3-4-10(2)12(7-9)15(19)18-14-6-5-11(16(20)21)8-13(14)17/h3-8H,1-2H3,(H,18,19)(H,20,21)
InChIKeyVVYZXXANBSEQAP-UHFFFAOYSA-N
XLogP3.39
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500287.29
LogP ≤ 53.39
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 4-[(2,5-dimethylbenzoyl)amino]-3-fluorobenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[(2,5-dimethylbenzoyl)amino]-3-fluorobenzoic acid?
The IUPAC name of 4-[(2,5-dimethylbenzoyl)amino]-3-fluorobenzoic acid (CID 63189869) is 4-[(2,5-dimethylbenzoyl)amino]-3-fluorobenzoic acid.
What is the SMILES notation for 4-[(2,5-dimethylbenzoyl)amino]-3-fluorobenzoic acid?
The canonical SMILES for 4-[(2,5-dimethylbenzoyl)amino]-3-fluorobenzoic acid is Cc1ccc(C)c(C(=O)Nc2ccc(C(=O)O)cc2F)c1.
What is the InChIKey of 4-[(2,5-dimethylbenzoyl)amino]-3-fluorobenzoic acid?
The InChIKey is VVYZXXANBSEQAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14FNO3/c1-9-3-4-10(2)12(7-9)15(19)18-14-6-5-11(16(20)21)8-13(14)17/h3-8H,1-2H3,(H,18,19)(H,20,21).
What are the key properties of 4-[(2,5-dimethylbenzoyl)amino]-3-fluorobenzoic acid?
4-[(2,5-dimethylbenzoyl)amino]-3-fluorobenzoic acid has a molecular weight of 287.29 g/mol, XLogP of 3.39, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,5-dimethylbenzoyl)amino]-3-fluorobenzoic acid is sourced from PubChem (CID 63189869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).