C14H16N3O2+ — CID 63192799
3,5-dihydro-2H-1,4-benzoxazepin-4-yl-(3-methylimidazol-3-ium-1-yl)methanone (PubChem CID 63192799) has the molecular formula C14H16N3O2+ and a molecular weight of 258.30 g/mol. Its IUPAC name is 3,5-dihydro-2H-1,4-benzoxazepin-4-yl-(3-methylimidazol-3-ium-1-yl)methanone.
| Compound Name | 3,5-dihydro-2H-1,4-benzoxazepin-4-yl-(3-methylimidazol-3-ium-1-yl)methanone |
|---|---|
| PubChem CID | 63192799 |
| Molecular Formula | C14H16N3O2+ |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 3,5-dihydro-2H-1,4-benzoxazepin-4-yl-(3-methylimidazol-3-ium-1-yl)methanone |
| SMILES | C[n+]1ccn(C(=O)N2CCOc3ccccc3C2)c1 |
| InChI | InChI=1S/C14H16N3O2/c1-15-6-7-17(11-15)14(18)16-8-9-19-13-5-3-2-4-12(13)10-16/h2-7,11H,8-10H2,1H3/q+1 |
| InChIKey | UQQBLDLVNWDPSJ-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 38.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|