C9H13N3O4 — CID 63199115
1-(1,3-dimethyl-4-nitropyrazol-5-yl)-3-methoxypropan-2-one (PubChem CID 63199115) has the molecular formula C9H13N3O4 and a molecular weight of 227.22 g/mol. Its IUPAC name is 1-(1,3-dimethyl-4-nitropyrazol-5-yl)-3-methoxypropan-2-one.
| Compound Name | 1-(1,3-dimethyl-4-nitropyrazol-5-yl)-3-methoxypropan-2-one |
|---|---|
| PubChem CID | 63199115 |
| Molecular Formula | C9H13N3O4 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | 1-(1,3-dimethyl-4-nitropyrazol-5-yl)-3-methoxypropan-2-one |
| SMILES | COCC(=O)Cc1c([N+](=O)[O-])c(C)nn1C |
| InChI | InChI=1S/C9H13N3O4/c1-6-9(12(14)15)8(11(2)10-6)4-7(13)5-16-3/h4-5H2,1-3H3 |
| InChIKey | ZJMLFGHEHITSMZ-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 87.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|