C10H21N3OS — CID 63224012
2-[(4-amino-4-sulfanylidenebutan-2-yl)-methylamino]-N,N-dimethylpropanamide (PubChem CID 63224012) has the molecular formula C10H21N3OS and a molecular weight of 231.36 g/mol. Its IUPAC name is 2-[(4-amino-4-sulfanylidenebutan-2-yl)-methylamino]-N,N-dimethylpropanamide.
| Compound Name | 2-[(4-amino-4-sulfanylidenebutan-2-yl)-methylamino]-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 63224012 |
| Molecular Formula | C10H21N3OS |
| Molecular Weight | 231.36 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | 2-[(4-amino-4-sulfanylidenebutan-2-yl)-methylamino]-N,N-dimethylpropanamide |
| SMILES | CC(CC(N)=S)N(C)C(C)C(=O)N(C)C |
| InChI | InChI=1S/C10H21N3OS/c1-7(6-9(11)15)13(5)8(2)10(14)12(3)4/h7-8H,6H2,1-5H3,(H2,11,15) |
| InChIKey | KZHMYQDZIMAYTN-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.36 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|