C15H25N3O — CID 63233562
4-N-(2-morpholin-4-ylethyl)-4-N-propylbenzene-1,4-diamine (PubChem CID 63233562) has the molecular formula C15H25N3O and a molecular weight of 263.38 g/mol. Its IUPAC name is 4-N-(2-morpholin-4-ylethyl)-4-N-propylbenzene-1,4-diamine.
| Compound Name | 4-N-(2-morpholin-4-ylethyl)-4-N-propylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 63233562 |
| Molecular Formula | C15H25N3O |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.20 |
| IUPAC Name | 4-N-(2-morpholin-4-ylethyl)-4-N-propylbenzene-1,4-diamine |
| SMILES | CCCN(CCN1CCOCC1)c1ccc(N)cc1 |
| InChI | InChI=1S/C15H25N3O/c1-2-7-18(15-5-3-14(16)4-6-15)9-8-17-10-12-19-13-11-17/h3-6H,2,7-13,16H2,1H3 |
| InChIKey | NQJZYLGNFCNFIP-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|