C13H15NO2S3 — CID 63238348
2-(4-methylsulfonylphenyl)sulfanyl-2-thiophen-2-ylethanamine (PubChem CID 63238348) has the molecular formula C13H15NO2S3 and a molecular weight of 313.47 g/mol. Its IUPAC name is 2-(4-methylsulfonylphenyl)sulfanyl-2-thiophen-2-ylethanamine.
| Compound Name | 2-(4-methylsulfonylphenyl)sulfanyl-2-thiophen-2-ylethanamine |
|---|---|
| PubChem CID | 63238348 |
| Molecular Formula | C13H15NO2S3 |
| Molecular Weight | 313.47 g/mol |
| Exact Mass | 313.03 |
| IUPAC Name | 2-(4-methylsulfonylphenyl)sulfanyl-2-thiophen-2-ylethanamine |
| SMILES | CS(=O)(=O)c1ccc(SC(CN)c2cccs2)cc1 |
| InChI | InChI=1S/C13H15NO2S3/c1-19(15,16)11-6-4-10(5-7-11)18-13(9-14)12-3-2-8-17-12/h2-8,13H,9,14H2,1H3 |
| InChIKey | TXOVFDIQNRTRTL-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.47 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |