2-[(2-aminocyclopentyl)sulfamoyl]propanoic acid

C8H16N2O4S — CID 63252218

IUPAC2-[(2-aminocyclopentyl)sulfamoyl]propanoic acid
SMILESCC(C(=O)O)S(=O)(=O)NC1CCCC1N
InChIInChI=1S/C8H16N2O4S/c1-5(8(11)12)15(13,14)10-7-4-2-3-6(7)9/h5-7,10H,2-4,9H2,1H3,(H,11,12)
InChIKeyXIACPPCOYIMZOZ-UHFFFAOYSA-N
MW236.29 g/mol
LogP-0.74
Rot. Bonds4

About 2-[(2-aminocyclopentyl)sulfamoyl]propanoic acid

2-[(2-aminocyclopentyl)sulfamoyl]propanoic acid (PubChem CID 63252218) has the molecular formula C8H16N2O4S and a molecular weight of 236.29 g/mol. Its IUPAC name is 2-[(2-aminocyclopentyl)sulfamoyl]propanoic acid.

Molecular Properties

Compound Name2-[(2-aminocyclopentyl)sulfamoyl]propanoic acid
PubChem CID63252218
Molecular FormulaC8H16N2O4S
Molecular Weight236.29 g/mol
Exact Mass236.08
IUPAC Name2-[(2-aminocyclopentyl)sulfamoyl]propanoic acid
SMILESCC(C(=O)O)S(=O)(=O)NC1CCCC1N
InChIInChI=1S/C8H16N2O4S/c1-5(8(11)12)15(13,14)10-7-4-2-3-6(7)9/h5-7,10H,2-4,9H2,1H3,(H,11,12)
InChIKeyXIACPPCOYIMZOZ-UHFFFAOYSA-N
XLogP-0.74
TPSA109.49 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500236.29
LogP ≤ 5-0.74
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Analyze 2-[(2-aminocyclopentyl)sulfamoyl]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-(8-tricyclo[5.2.1.02,6]decanylsulfamoyl)propanoic acid
CID 61455278
2-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-ylsulfamoyl)propanoic acid
CID 54947383
2-[(1-methoxy-1-oxopropan-2-yl)sulfonylamino]cyclohexane-1-carboxylic acid
CID 64816642
2-[[(1R)-1-cyclopentylethyl]sulfamoyl]propanoic acid
CID 81386001
N-(2-aminocyclopentyl)-3-methylbutane-1-sulfonamide
CID 63857525
2-(dicyclopropylmethylsulfamoyl)propanoic acid
CID 61482345
2-(1-cyclopropylethylsulfamoyl)propanoic acid
CID 61454821
propan-2-yl N-[(2-aminocycloheptyl)sulfamoyl]carbamate
CID 114464755
2-[[(3S)-piperidin-3-yl]sulfamoyl]propanoic acid
CID 104982569
2-[[(2S)-1-methoxy-1-oxopropan-2-yl]sulfamoyl]propanoic acid
CID 61455040
methyl 2-[(2-methylpiperidin-3-yl)sulfamoyl]propanoate
CID 114695160
2-[(1S,2R)-2-aminocyclohexyl]propanoic acid
CID 130898751

Frequently Asked Questions

What is the IUPAC name of 2-[(2-aminocyclopentyl)sulfamoyl]propanoic acid?
The IUPAC name of 2-[(2-aminocyclopentyl)sulfamoyl]propanoic acid (CID 63252218) is 2-[(2-aminocyclopentyl)sulfamoyl]propanoic acid.
What is the SMILES notation for 2-[(2-aminocyclopentyl)sulfamoyl]propanoic acid?
The canonical SMILES for 2-[(2-aminocyclopentyl)sulfamoyl]propanoic acid is CC(C(=O)O)S(=O)(=O)NC1CCCC1N.
What is the InChIKey of 2-[(2-aminocyclopentyl)sulfamoyl]propanoic acid?
The InChIKey is XIACPPCOYIMZOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O4S/c1-5(8(11)12)15(13,14)10-7-4-2-3-6(7)9/h5-7,10H,2-4,9H2,1H3,(H,11,12).
What are the key properties of 2-[(2-aminocyclopentyl)sulfamoyl]propanoic acid?
2-[(2-aminocyclopentyl)sulfamoyl]propanoic acid has a molecular weight of 236.29 g/mol, XLogP of -0.74, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-aminocyclopentyl)sulfamoyl]propanoic acid is sourced from PubChem (CID 63252218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).