C11H9FN4O3 — CID 63257428
N-(2-amino-5-fluorophenyl)-2,4-dioxo-1H-pyrimidine-6-carboxamide (PubChem CID 63257428) has the molecular formula C11H9FN4O3 and a molecular weight of 264.22 g/mol. Its IUPAC name is N-(2-amino-5-fluorophenyl)-2,4-dioxo-1H-pyrimidine-6-carboxamide.
| Compound Name | N-(2-amino-5-fluorophenyl)-2,4-dioxo-1H-pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 63257428 |
| Molecular Formula | C11H9FN4O3 |
| Molecular Weight | 264.22 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | N-(2-amino-5-fluorophenyl)-2,4-dioxo-1H-pyrimidine-6-carboxamide |
| SMILES | Nc1ccc(F)cc1NC(=O)c1cc(=O)[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C11H9FN4O3/c12-5-1-2-6(13)7(3-5)14-10(18)8-4-9(17)16-11(19)15-8/h1-4H,13H2,(H,14,18)(H2,15,16,17,19) |
| InChIKey | WTPWPCCDUSMVEB-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 120.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.22 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|