C19H21N5O3 — CID 632637
5-[[4-(4-aminophenoxy)-3,5-dimethoxyphenyl]methyl]pyrimidine-2,4-diamine (PubChem CID 632637) has the molecular formula C19H21N5O3 and a molecular weight of 367.41 g/mol. Its IUPAC name is 5-[[4-(4-aminophenoxy)-3,5-dimethoxyphenyl]methyl]pyrimidine-2,4-diamine.
| Compound Name | 5-[[4-(4-aminophenoxy)-3,5-dimethoxyphenyl]methyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 632637 |
| Molecular Formula | C19H21N5O3 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | 5-[[4-(4-aminophenoxy)-3,5-dimethoxyphenyl]methyl]pyrimidine-2,4-diamine |
| SMILES | COc1cc(Cc2cnc(N)nc2N)cc(OC)c1Oc1ccc(N)cc1 |
| InChI | InChI=1S/C19H21N5O3/c1-25-15-8-11(7-12-10-23-19(22)24-18(12)21)9-16(26-2)17(15)27-14-5-3-13(20)4-6-14/h3-6,8-10H,7,20H2,1-2H3,(H4,21,22,23,24) |
| InChIKey | BAHLFRPSXQSPTQ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 131.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|