C14H25N3S — CID 63265653
N-methyl-N-(2-piperazin-1-ylethyl)-1-thiophen-2-ylpropan-1-amine (PubChem CID 63265653) has the molecular formula C14H25N3S and a molecular weight of 267.44 g/mol. Its IUPAC name is N-methyl-N-(2-piperazin-1-ylethyl)-1-thiophen-2-ylpropan-1-amine.
| Compound Name | N-methyl-N-(2-piperazin-1-ylethyl)-1-thiophen-2-ylpropan-1-amine |
|---|---|
| PubChem CID | 63265653 |
| Molecular Formula | C14H25N3S |
| Molecular Weight | 267.44 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | N-methyl-N-(2-piperazin-1-ylethyl)-1-thiophen-2-ylpropan-1-amine |
| SMILES | CCC(c1cccs1)N(C)CCN1CCNCC1 |
| InChI | InChI=1S/C14H25N3S/c1-3-13(14-5-4-12-18-14)16(2)10-11-17-8-6-15-7-9-17/h4-5,12-13,15H,3,6-11H2,1-2H3 |
| InChIKey | HJZVCRYNMYEZLK-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.44 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |