C12H23N5 — CID 63266461
N-methyl-2-piperazin-1-yl-N-(2-pyrazol-1-ylethyl)ethanamine (PubChem CID 63266461) has the molecular formula C12H23N5 and a molecular weight of 237.35 g/mol. Its IUPAC name is N-methyl-2-piperazin-1-yl-N-(2-pyrazol-1-ylethyl)ethanamine.
| Compound Name | N-methyl-2-piperazin-1-yl-N-(2-pyrazol-1-ylethyl)ethanamine |
|---|---|
| PubChem CID | 63266461 |
| Molecular Formula | C12H23N5 |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.20 |
| IUPAC Name | N-methyl-2-piperazin-1-yl-N-(2-pyrazol-1-ylethyl)ethanamine |
| SMILES | CN(CCN1CCNCC1)CCn1cccn1 |
| InChI | InChI=1S/C12H23N5/c1-15(10-12-17-6-2-3-14-17)9-11-16-7-4-13-5-8-16/h2-3,6,13H,4-5,7-12H2,1H3 |
| InChIKey | MDTRKZVELSUTDQ-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 36.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |