C13H23N5O — CID 120982786
3-[methyl(2-pyrazol-1-ylethyl)amino]-1-piperazin-1-ylpropan-1-one (PubChem CID 120982786) has the molecular formula C13H23N5O and a molecular weight of 265.36 g/mol. Its IUPAC name is 3-[methyl(2-pyrazol-1-ylethyl)amino]-1-piperazin-1-ylpropan-1-one.
| Compound Name | 3-[methyl(2-pyrazol-1-ylethyl)amino]-1-piperazin-1-ylpropan-1-one |
|---|---|
| PubChem CID | 120982786 |
| Molecular Formula | C13H23N5O |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.19 |
| IUPAC Name | 3-[methyl(2-pyrazol-1-ylethyl)amino]-1-piperazin-1-ylpropan-1-one |
| SMILES | CN(CCC(=O)N1CCNCC1)CCn1cccn1 |
| InChI | InChI=1S/C13H23N5O/c1-16(11-12-18-7-2-4-15-18)8-3-13(19)17-9-5-14-6-10-17/h2,4,7,14H,3,5-6,8-12H2,1H3 |
| InChIKey | NKNYVOVONBCFHH-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |