About CID 6327105
CID 6327105 (PubChem CID 6327105) has the molecular formula H6O5Pb2Si
and a molecular weight of 528.53 g/mol.
Molecular Properties
| Compound Name | CID 6327105 |
| PubChem CID | 6327105 |
| Molecular Formula | H6O5Pb2Si |
| Molecular Weight | 528.53 g/mol |
| Exact Mass | 529.95 |
| IUPAC Name | — |
| SMILES | O.O.O=[Si](O)O.[Pb].[Pb] |
| InChI | InChI=1S/H2O3Si.2H2O.2Pb/c1-4(2)3;;;;/h1-2H;2*1H2;; |
| InChIKey | LWWXFHQIVMYZLO-UHFFFAOYSA-N |
| XLogP | -4.02 |
| TPSA | 120.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 528.53 |
| LogP ≤ 5 | -4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 6327105 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 6327105?
The IUPAC name of CID 6327105 (CID 6327105) is not available.
What is the SMILES notation for CID 6327105?
The canonical SMILES for CID 6327105 is O.O.O=[Si](O)O.[Pb].[Pb].
What is the InChIKey of CID 6327105?
The InChIKey is LWWXFHQIVMYZLO-UHFFFAOYSA-N. The full InChI is InChI=1S/H2O3Si.2H2O.2Pb/c1-4(2)3;;;;/h1-2H;2*1H2;;.
What are the key properties of CID 6327105?
CID 6327105 has a molecular weight of 528.53 g/mol, XLogP of -4.02, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 6327105 is sourced from PubChem (CID 6327105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).