C12H15N5O2 — CID 63271650
2-[(2-hydrazinyl-4-pyridinyl)methyl]-4,5-dimethyl-1H-pyridazine-3,6-dione (PubChem CID 63271650) has the molecular formula C12H15N5O2 and a molecular weight of 261.28 g/mol. Its IUPAC name is 2-[(2-hydrazinyl-4-pyridinyl)methyl]-4,5-dimethyl-1H-pyridazine-3,6-dione.
| Compound Name | 2-[(2-hydrazinyl-4-pyridinyl)methyl]-4,5-dimethyl-1H-pyridazine-3,6-dione |
|---|---|
| PubChem CID | 63271650 |
| Molecular Formula | C12H15N5O2 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | 2-[(2-hydrazinyl-4-pyridinyl)methyl]-4,5-dimethyl-1H-pyridazine-3,6-dione |
| SMILES | Cc1c(C)c(=O)n(Cc2ccnc(NN)c2)[nH]c1=O |
| InChI | InChI=1S/C12H15N5O2/c1-7-8(2)12(19)17(16-11(7)18)6-9-3-4-14-10(5-9)15-13/h3-5H,6,13H2,1-2H3,(H,14,15)(H,16,18) |
| InChIKey | CWHXOBZXZYLTTI-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 105.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|