C13H17BrN4O2 — CID 63289968
5-bromo-N-(2-cyanoethyl)-N-(2-methoxyethyl)-2-(methylamino)pyridine-3-carboxamide (PubChem CID 63289968) has the molecular formula C13H17BrN4O2 and a molecular weight of 341.21 g/mol. Its IUPAC name is 5-bromo-N-(2-cyanoethyl)-N-(2-methoxyethyl)-2-(methylamino)pyridine-3-carboxamide.
| Compound Name | 5-bromo-N-(2-cyanoethyl)-N-(2-methoxyethyl)-2-(methylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 63289968 |
| Molecular Formula | C13H17BrN4O2 |
| Molecular Weight | 341.21 g/mol |
| Exact Mass | 340.05 |
| IUPAC Name | 5-bromo-N-(2-cyanoethyl)-N-(2-methoxyethyl)-2-(methylamino)pyridine-3-carboxamide |
| SMILES | CNc1ncc(Br)cc1C(=O)N(CCC#N)CCOC |
| InChI | InChI=1S/C13H17BrN4O2/c1-16-12-11(8-10(14)9-17-12)13(19)18(5-3-4-15)6-7-20-2/h8-9H,3,5-7H2,1-2H3,(H,16,17) |
| InChIKey | POQZBICXDJDERJ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 78.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.21 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |