C11H24BSi — CID 6329169
2-Pentene, 3-diethylboryl-2-dimethylsilyl- (PubChem CID 6329169) has the molecular formula C11H24BSi and a molecular weight of 195.21 g/mol.
| Compound Name | 2-Pentene, 3-diethylboryl-2-dimethylsilyl- |
|---|---|
| PubChem CID | 6329169 |
| Molecular Formula | C11H24BSi |
| Molecular Weight | 195.21 g/mol |
| Exact Mass | 195.17 |
| IUPAC Name | — |
| SMILES | CCB(CC)/C(CC)=C(\C)[Si](C)C |
| InChI | InChI=1S/C11H24BSi/c1-7-11(10(4)13(5)6)12(8-2)9-3/h7-9H2,1-6H3/b11-10+ |
| InChIKey | QIHCBAWDEHBMFS-ZHACJKMWSA-N |
| XLogP | 4.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.21 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|