C10H21BOSi — CID 597424
2,4,5-triethyl-2,3-dimethyl-1,2,5-oxasilaborole (PubChem CID 597424) has the molecular formula C10H21BOSi and a molecular weight of 196.17 g/mol. Its IUPAC name is 2,4,5-triethyl-2,3-dimethyl-1,2,5-oxasilaborole.
| Compound Name | 2,4,5-triethyl-2,3-dimethyl-1,2,5-oxasilaborole |
|---|---|
| PubChem CID | 597424 |
| Molecular Formula | C10H21BOSi |
| Molecular Weight | 196.17 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | 2,4,5-triethyl-2,3-dimethyl-1,2,5-oxasilaborole |
| SMILES | CCB1O[Si](C)(CC)C(C)=C1CC |
| InChI | InChI=1S/C10H21BOSi/c1-6-10-9(4)13(5,8-3)12-11(10)7-2/h6-8H2,1-5H3 |
| InChIKey | LQQBPMXEOGDPAL-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.17 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|