C9H19BO2Si — CID 13329734
5-ethoxy-4-ethyl-2,2,3-trimethyl-1,2,5-oxasilaborole (PubChem CID 13329734) has the molecular formula C9H19BO2Si and a molecular weight of 198.15 g/mol. Its IUPAC name is 5-ethoxy-4-ethyl-2,2,3-trimethyl-1,2,5-oxasilaborole.
| Compound Name | 5-ethoxy-4-ethyl-2,2,3-trimethyl-1,2,5-oxasilaborole |
|---|---|
| PubChem CID | 13329734 |
| Molecular Formula | C9H19BO2Si |
| Molecular Weight | 198.15 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | 5-ethoxy-4-ethyl-2,2,3-trimethyl-1,2,5-oxasilaborole |
| SMILES | CCOB1O[Si](C)(C)C(C)=C1CC |
| InChI | InChI=1S/C9H19BO2Si/c1-6-9-8(3)13(4,5)12-10(9)11-7-2/h6-7H2,1-5H3 |
| InChIKey | FEZXUDWJPDAKNQ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.15 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|