C11H23BOSi — CID 592787
5-tert-butyl-4-ethyl-2,2,3-trimethyl-1,2,5-oxasilaborole (PubChem CID 592787) has the molecular formula C11H23BOSi and a molecular weight of 210.20 g/mol. Its IUPAC name is 5-tert-butyl-4-ethyl-2,2,3-trimethyl-1,2,5-oxasilaborole.
| Compound Name | 5-tert-butyl-4-ethyl-2,2,3-trimethyl-1,2,5-oxasilaborole |
|---|---|
| PubChem CID | 592787 |
| Molecular Formula | C11H23BOSi |
| Molecular Weight | 210.20 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | 5-tert-butyl-4-ethyl-2,2,3-trimethyl-1,2,5-oxasilaborole |
| SMILES | CCC1=C(C)[Si](C)(C)OB1C(C)(C)C |
| InChI | InChI=1S/C11H23BOSi/c1-8-10-9(2)14(6,7)13-12(10)11(3,4)5/h8H2,1-7H3 |
| InChIKey | DZYNWILLDRMBSJ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.20 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|