C11H25BOSi — CID 14872838
4,5,5-triethyl-2,2,3-trimethyl-1-oxonia-2-sila-5-boranuidacyclopent-3-ene (PubChem CID 14872838) has the molecular formula C11H25BOSi and a molecular weight of 212.22 g/mol. Its IUPAC name is 4,5,5-triethyl-2,2,3-trimethyl-1-oxonia-2-sila-5-boranuidacyclopent-3-ene.
| Compound Name | 4,5,5-triethyl-2,2,3-trimethyl-1-oxonia-2-sila-5-boranuidacyclopent-3-ene |
|---|---|
| PubChem CID | 14872838 |
| Molecular Formula | C11H25BOSi |
| Molecular Weight | 212.22 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | 4,5,5-triethyl-2,2,3-trimethyl-1-oxonia-2-sila-5-boranuidacyclopent-3-ene |
| SMILES | CCC1=C(C)[Si](C)(C)[OH+][B-]1(CC)CC |
| InChI | InChI=1S/C11H25BOSi/c1-7-11-10(4)14(5,6)13-12(11,8-2)9-3/h13H,7-9H2,1-6H3 |
| InChIKey | ACSZFYWKSLJMRP-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 12.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.22 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|