C16H19FO3 — CID 63292963
5-fluoro-2-[(6-methylcyclohex-3-en-1-yl)methoxymethyl]benzoic acid (PubChem CID 63292963) has the molecular formula C16H19FO3 and a molecular weight of 278.32 g/mol. Its IUPAC name is 5-fluoro-2-[(6-methylcyclohex-3-en-1-yl)methoxymethyl]benzoic acid.
| Compound Name | 5-fluoro-2-[(6-methylcyclohex-3-en-1-yl)methoxymethyl]benzoic acid |
|---|---|
| PubChem CID | 63292963 |
| Molecular Formula | C16H19FO3 |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 5-fluoro-2-[(6-methylcyclohex-3-en-1-yl)methoxymethyl]benzoic acid |
| SMILES | CC1CC=CCC1COCc1ccc(F)cc1C(=O)O |
| InChI | InChI=1S/C16H19FO3/c1-11-4-2-3-5-12(11)9-20-10-13-6-7-14(17)8-15(13)16(18)19/h2-3,6-8,11-12H,4-5,9-10H2,1H3,(H,18,19) |
| InChIKey | OAHNGHPFNKTHAT-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|