C12H14N6O3 — CID 63293487
2-hydrazinyl-N-[(1-methylimidazol-2-yl)methyl]-5-nitrobenzamide (PubChem CID 63293487) has the molecular formula C12H14N6O3 and a molecular weight of 290.28 g/mol. Its IUPAC name is 2-hydrazinyl-N-[(1-methylimidazol-2-yl)methyl]-5-nitrobenzamide.
| Compound Name | 2-hydrazinyl-N-[(1-methylimidazol-2-yl)methyl]-5-nitrobenzamide |
|---|---|
| PubChem CID | 63293487 |
| Molecular Formula | C12H14N6O3 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 2-hydrazinyl-N-[(1-methylimidazol-2-yl)methyl]-5-nitrobenzamide |
| SMILES | Cn1ccnc1CNC(=O)c1cc([N+](=O)[O-])ccc1NN |
| InChI | InChI=1S/C12H14N6O3/c1-17-5-4-14-11(17)7-15-12(19)9-6-8(18(20)21)2-3-10(9)16-13/h2-6,16H,7,13H2,1H3,(H,15,19) |
| InChIKey | KUGDXPDYIJGNTO-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 128.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|