C14H18N4O2 — CID 63295642
N-(2-methoxyphenyl)-2-[(1-methylimidazol-2-yl)methylamino]acetamide (PubChem CID 63295642) has the molecular formula C14H18N4O2 and a molecular weight of 274.32 g/mol. Its IUPAC name is N-(2-methoxyphenyl)-2-[(1-methylimidazol-2-yl)methylamino]acetamide.
| Compound Name | N-(2-methoxyphenyl)-2-[(1-methylimidazol-2-yl)methylamino]acetamide |
|---|---|
| PubChem CID | 63295642 |
| Molecular Formula | C14H18N4O2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | N-(2-methoxyphenyl)-2-[(1-methylimidazol-2-yl)methylamino]acetamide |
| SMILES | COc1ccccc1NC(=O)CNCc1nccn1C |
| InChI | InChI=1S/C14H18N4O2/c1-18-8-7-16-13(18)9-15-10-14(19)17-11-5-3-4-6-12(11)20-2/h3-8,15H,9-10H2,1-2H3,(H,17,19) |
| InChIKey | OEBBRIUUCHRRKE-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |