C12H16ClNO2 — CID 63307779
4-chloro-N-(3-hydroxy-2,4-dimethylphenyl)butanamide (PubChem CID 63307779) has the molecular formula C12H16ClNO2 and a molecular weight of 241.72 g/mol. Its IUPAC name is 4-chloro-N-(3-hydroxy-2,4-dimethylphenyl)butanamide.
| Compound Name | 4-chloro-N-(3-hydroxy-2,4-dimethylphenyl)butanamide |
|---|---|
| PubChem CID | 63307779 |
| Molecular Formula | C12H16ClNO2 |
| Molecular Weight | 241.72 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 4-chloro-N-(3-hydroxy-2,4-dimethylphenyl)butanamide |
| SMILES | Cc1ccc(NC(=O)CCCCl)c(C)c1O |
| InChI | InChI=1S/C12H16ClNO2/c1-8-5-6-10(9(2)12(8)16)14-11(15)4-3-7-13/h5-6,16H,3-4,7H2,1-2H3,(H,14,15) |
| InChIKey | VELXCOVEXHFDPQ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.72 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|