C11H15NO3 — CID 64590774
N-(3-hydroxy-2,4-dimethylphenyl)-2-methoxyacetamide (PubChem CID 64590774) has the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. Its IUPAC name is N-(3-hydroxy-2,4-dimethylphenyl)-2-methoxyacetamide.
| Compound Name | N-(3-hydroxy-2,4-dimethylphenyl)-2-methoxyacetamide |
|---|---|
| PubChem CID | 64590774 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | N-(3-hydroxy-2,4-dimethylphenyl)-2-methoxyacetamide |
| SMILES | COCC(=O)Nc1ccc(C)c(O)c1C |
| InChI | InChI=1S/C11H15NO3/c1-7-4-5-9(8(2)11(7)14)12-10(13)6-15-3/h4-5,14H,6H2,1-3H3,(H,12,13) |
| InChIKey | WTIOJAQMZDVRAN-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |