C12H15ClN2OS2 — CID 63310390
3-[3-[4-(chloromethyl)-1,3-thiazol-2-yl]propyl]-4,5-dimethyl-1,3-thiazol-2-one (PubChem CID 63310390) has the molecular formula C12H15ClN2OS2 and a molecular weight of 302.85 g/mol. Its IUPAC name is 3-[3-[4-(chloromethyl)-1,3-thiazol-2-yl]propyl]-4,5-dimethyl-1,3-thiazol-2-one.
| Compound Name | 3-[3-[4-(chloromethyl)-1,3-thiazol-2-yl]propyl]-4,5-dimethyl-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 63310390 |
| Molecular Formula | C12H15ClN2OS2 |
| Molecular Weight | 302.85 g/mol |
| Exact Mass | 302.03 |
| IUPAC Name | 3-[3-[4-(chloromethyl)-1,3-thiazol-2-yl]propyl]-4,5-dimethyl-1,3-thiazol-2-one |
| SMILES | Cc1sc(=O)n(CCCc2nc(CCl)cs2)c1C |
| InChI | InChI=1S/C12H15ClN2OS2/c1-8-9(2)18-12(16)15(8)5-3-4-11-14-10(6-13)7-17-11/h7H,3-6H2,1-2H3 |
| InChIKey | NYISJIDGCGZGLL-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.85 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|