C14H20N6S — CID 63311425
1-[3-[(4,5-dicyclopropyl-1,2,4-triazol-3-yl)sulfanyl]propyl]pyrazol-3-amine (PubChem CID 63311425) has the molecular formula C14H20N6S and a molecular weight of 304.42 g/mol. Its IUPAC name is 1-[3-[(4,5-dicyclopropyl-1,2,4-triazol-3-yl)sulfanyl]propyl]pyrazol-3-amine.
| Compound Name | 1-[3-[(4,5-dicyclopropyl-1,2,4-triazol-3-yl)sulfanyl]propyl]pyrazol-3-amine |
|---|---|
| PubChem CID | 63311425 |
| Molecular Formula | C14H20N6S |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 1-[3-[(4,5-dicyclopropyl-1,2,4-triazol-3-yl)sulfanyl]propyl]pyrazol-3-amine |
| SMILES | Nc1ccn(CCCSc2nnc(C3CC3)n2C2CC2)n1 |
| InChI | InChI=1S/C14H20N6S/c15-12-6-8-19(18-12)7-1-9-21-14-17-16-13(10-2-3-10)20(14)11-4-5-11/h6,8,10-11H,1-5,7,9H2,(H2,15,18) |
| InChIKey | RHBDSYNTZRBUBW-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 74.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|