C14H19ClN4OS — CID 63313043
[5-[2-(2-chlorophenoxy)ethylsulfanyl]-4-propan-2-yl-1,2,4-triazol-3-yl]methanamine (PubChem CID 63313043) has the molecular formula C14H19ClN4OS and a molecular weight of 326.85 g/mol. Its IUPAC name is [5-[2-(2-chlorophenoxy)ethylsulfanyl]-4-propan-2-yl-1,2,4-triazol-3-yl]methanamine.
| Compound Name | [5-[2-(2-chlorophenoxy)ethylsulfanyl]-4-propan-2-yl-1,2,4-triazol-3-yl]methanamine |
|---|---|
| PubChem CID | 63313043 |
| Molecular Formula | C14H19ClN4OS |
| Molecular Weight | 326.85 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | [5-[2-(2-chlorophenoxy)ethylsulfanyl]-4-propan-2-yl-1,2,4-triazol-3-yl]methanamine |
| SMILES | CC(C)n1c(CN)nnc1SCCOc1ccccc1Cl |
| InChI | InChI=1S/C14H19ClN4OS/c1-10(2)19-13(9-16)17-18-14(19)21-8-7-20-12-6-4-3-5-11(12)15/h3-6,10H,7-9,16H2,1-2H3 |
| InChIKey | VQOHLWUYKYHJAI-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.85 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|